C23H20ClN5O — CID 129228098
2-[[2-[[4-(4-chlorophenoxy)phenyl]methylamino]-3-methylbenzimidazol-5-yl]amino]acetonitrile (PubChem CID 129228098) has the molecular formula C23H20ClN5O and a molecular weight of 417.90 g/mol. Its IUPAC name is 2-[[2-[[4-(4-chlorophenoxy)phenyl]methylamino]-3-methylbenzimidazol-5-yl]amino]acetonitrile.
| Compound Name | 2-[[2-[[4-(4-chlorophenoxy)phenyl]methylamino]-3-methylbenzimidazol-5-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 129228098 |
| Molecular Formula | C23H20ClN5O |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-[[2-[[4-(4-chlorophenoxy)phenyl]methylamino]-3-methylbenzimidazol-5-yl]amino]acetonitrile |
| SMILES | Cn1c(NCc2ccc(Oc3ccc(Cl)cc3)cc2)nc2ccc(NCC#N)cc21 |
| InChI | InChI=1S/C23H20ClN5O/c1-29-22-14-18(26-13-12-25)6-11-21(22)28-23(29)27-15-16-2-7-19(8-3-16)30-20-9-4-17(24)5-10-20/h2-11,14,26H,13,15H2,1H3,(H,27,28) |
| InChIKey | CGCFHHRGXZJWAZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|