C25H21ClN6O — CID 118859201
2-N-[[4-[5-(4-chlorophenyl)pyrimidin-2-yl]oxyphenyl]methyl]-3-methylbenzimidazole-2,5-diamine (PubChem CID 118859201) has the molecular formula C25H21ClN6O and a molecular weight of 456.94 g/mol. Its IUPAC name is 2-N-[[4-[5-(4-chlorophenyl)pyrimidin-2-yl]oxyphenyl]methyl]-3-methylbenzimidazole-2,5-diamine.
| Compound Name | 2-N-[[4-[5-(4-chlorophenyl)pyrimidin-2-yl]oxyphenyl]methyl]-3-methylbenzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 118859201 |
| Molecular Formula | C25H21ClN6O |
| Molecular Weight | 456.94 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-N-[[4-[5-(4-chlorophenyl)pyrimidin-2-yl]oxyphenyl]methyl]-3-methylbenzimidazole-2,5-diamine |
| SMILES | Cn1c(NCc2ccc(Oc3ncc(-c4ccc(Cl)cc4)cn3)cc2)nc2ccc(N)cc21 |
| InChI | InChI=1S/C25H21ClN6O/c1-32-23-12-20(27)8-11-22(23)31-24(32)28-13-16-2-9-21(10-3-16)33-25-29-14-18(15-30-25)17-4-6-19(26)7-5-17/h2-12,14-15H,13,27H2,1H3,(H,28,31) |
| InChIKey | ZUTIPMHMQUGIMM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.94 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|