C20H17ClFN5O — CID 129223471
2-N-[[4-[(5-chloro-2-pyridinyl)oxy]-3-fluorophenyl]methyl]-3-methylbenzimidazole-2,5-diamine (PubChem CID 129223471) has the molecular formula C20H17ClFN5O and a molecular weight of 397.84 g/mol. Its IUPAC name is 2-N-[[4-[(5-chloro-2-pyridinyl)oxy]-3-fluorophenyl]methyl]-3-methylbenzimidazole-2,5-diamine.
| Compound Name | 2-N-[[4-[(5-chloro-2-pyridinyl)oxy]-3-fluorophenyl]methyl]-3-methylbenzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 129223471 |
| Molecular Formula | C20H17ClFN5O |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-N-[[4-[(5-chloro-2-pyridinyl)oxy]-3-fluorophenyl]methyl]-3-methylbenzimidazole-2,5-diamine |
| SMILES | Cn1c(NCc2ccc(Oc3ccc(Cl)cn3)c(F)c2)nc2ccc(N)cc21 |
| InChI | InChI=1S/C20H17ClFN5O/c1-27-17-9-14(23)4-5-16(17)26-20(27)25-10-12-2-6-18(15(22)8-12)28-19-7-3-13(21)11-24-19/h2-9,11H,10,23H2,1H3,(H,25,26) |
| InChIKey | IKJNJHWKRXXLCM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|