C23H27NO5 — CID 134135965
4-(2-benzylphenoxy)-1-methylpiperidine;(E)-but-2-enedioic acid (PubChem CID 134135965) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 4-(2-benzylphenoxy)-1-methylpiperidine;(E)-but-2-enedioic acid.
| Compound Name | 4-(2-benzylphenoxy)-1-methylpiperidine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 134135965 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 4-(2-benzylphenoxy)-1-methylpiperidine;(E)-but-2-enedioic acid |
| SMILES | CN1CCC(Oc2ccccc2Cc2ccccc2)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H23NO.C4H4O4/c1-20-13-11-18(12-14-20)21-19-10-6-5-9-17(19)15-16-7-3-2-4-8-16;5-3(6)1-2-4(7)8/h2-10,18H,11-15H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | QLHABMLYWODKSV-WLHGVMLRSA-N |
| XLogP | 3.46 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|