C17H15N2O+ — CID 134136282
2-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile (PubChem CID 134136282) has the molecular formula C17H15N2O+ and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile.
| Compound Name | 2-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile |
|---|---|
| PubChem CID | 134136282 |
| Molecular Formula | C17H15N2O+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-(8-methoxy-3,4-dihydroisoquinolin-2-ium-2-yl)benzonitrile |
| SMILES | COc1cccc2c1C=[N+](c1ccccc1C#N)CC2 |
| InChI | InChI=1S/C17H15N2O/c1-20-17-8-4-6-13-9-10-19(12-15(13)17)16-7-3-2-5-14(16)11-18/h2-8,12H,9-10H2,1H3/q+1 |
| InChIKey | YXWFEONZZBWCTA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|