C26H30ClFN4O5 — CID 134137047
cyclohexyl 3-[(2-chloro-4-fluoro-3-methyl-5-nitrobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate (PubChem CID 134137047) has the molecular formula C26H30ClFN4O5 and a molecular weight of 533.00 g/mol. Its IUPAC name is cyclohexyl 3-[(2-chloro-4-fluoro-3-methyl-5-nitrobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | cyclohexyl 3-[(2-chloro-4-fluoro-3-methyl-5-nitrobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 134137047 |
| Molecular Formula | C26H30ClFN4O5 |
| Molecular Weight | 533.00 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | cyclohexyl 3-[(2-chloro-4-fluoro-3-methyl-5-nitrobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate |
| SMILES | Cc1c(F)c([N+](=O)[O-])cc(C(=O)Nc2cc(C(=O)OC3CCCCC3)ccc2N2CCN(C)CC2)c1Cl |
| InChI | InChI=1S/C26H30ClFN4O5/c1-16-23(27)19(15-22(24(16)28)32(35)36)25(33)29-20-14-17(26(34)37-18-6-4-3-5-7-18)8-9-21(20)31-12-10-30(2)11-13-31/h8-9,14-15,18H,3-7,10-13H2,1-2H3,(H,29,33) |
| InChIKey | NTIQYFYUMZEOGI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.00 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|