C25H31FN4O3 — CID 134144485
cyclohexyl 3-[(3-amino-4-fluorobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate (PubChem CID 134144485) has the molecular formula C25H31FN4O3 and a molecular weight of 454.55 g/mol. Its IUPAC name is cyclohexyl 3-[(3-amino-4-fluorobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | cyclohexyl 3-[(3-amino-4-fluorobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 134144485 |
| Molecular Formula | C25H31FN4O3 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | cyclohexyl 3-[(3-amino-4-fluorobenzoyl)amino]-4-(4-methylpiperazin-1-yl)benzoate |
| SMILES | CN1CCN(c2ccc(C(=O)OC3CCCCC3)cc2NC(=O)c2ccc(F)c(N)c2)CC1 |
| InChI | InChI=1S/C25H31FN4O3/c1-29-11-13-30(14-12-29)23-10-8-18(25(32)33-19-5-3-2-4-6-19)16-22(23)28-24(31)17-7-9-20(26)21(27)15-17/h7-10,15-16,19H,2-6,11-14,27H2,1H3,(H,28,31) |
| InChIKey | AVKUOEOZJRYWPN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|