C16H15BrFNO — CID 134137498
2-(3-fluorophenyl)-8-methoxy-3,4-dihydroisoquinolin-2-ium bromide (PubChem CID 134137498) has the molecular formula C16H15BrFNO and a molecular weight of 336.20 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-8-methoxy-3,4-dihydroisoquinolin-2-ium bromide.
| Compound Name | 2-(3-fluorophenyl)-8-methoxy-3,4-dihydroisoquinolin-2-ium bromide |
|---|---|
| PubChem CID | 134137498 |
| Molecular Formula | C16H15BrFNO |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-(3-fluorophenyl)-8-methoxy-3,4-dihydroisoquinolin-2-ium bromide |
| SMILES | COc1cccc2c1C=[N+](c1cccc(F)c1)CC2.[Br-] |
| InChI | InChI=1S/C16H15FNO.BrH/c1-19-16-7-2-4-12-8-9-18(11-15(12)16)14-6-3-5-13(17)10-14;/h2-7,10-11H,8-9H2,1H3;1H/q+1;/p-1 |
| InChIKey | FVOBPUMTZNETLD-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|