C14H10FNO2S — CID 134138373
N-(3-fluorophenyl)-1,1-dioxo-1-benzothiophen-7-amine (PubChem CID 134138373) has the molecular formula C14H10FNO2S and a molecular weight of 275.30 g/mol. Its IUPAC name is N-(3-fluorophenyl)-1,1-dioxo-1-benzothiophen-7-amine.
| Compound Name | N-(3-fluorophenyl)-1,1-dioxo-1-benzothiophen-7-amine |
|---|---|
| PubChem CID | 134138373 |
| Molecular Formula | C14H10FNO2S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | N-(3-fluorophenyl)-1,1-dioxo-1-benzothiophen-7-amine |
| SMILES | O=S1(=O)C=Cc2cccc(Nc3cccc(F)c3)c21 |
| InChI | InChI=1S/C14H10FNO2S/c15-11-4-2-5-12(9-11)16-13-6-1-3-10-7-8-19(17,18)14(10)13/h1-9,16H |
| InChIKey | OLRAASVQUDMECK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |