C26H27ClF2N2S — CID 134138482
1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-4-[(4-chlorophenyl)methyl]piperazine (PubChem CID 134138482) has the molecular formula C26H27ClF2N2S and a molecular weight of 473.03 g/mol. Its IUPAC name is 1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-4-[(4-chlorophenyl)methyl]piperazine.
| Compound Name | 1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-4-[(4-chlorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 134138482 |
| Molecular Formula | C26H27ClF2N2S |
| Molecular Weight | 473.03 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 1-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-4-[(4-chlorophenyl)methyl]piperazine |
| SMILES | Fc1ccc(C(SCCN2CCN(Cc3ccc(Cl)cc3)CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H27ClF2N2S/c27-23-7-1-20(2-8-23)19-31-15-13-30(14-16-31)17-18-32-26(21-3-9-24(28)10-4-21)22-5-11-25(29)12-6-22/h1-12,26H,13-19H2 |
| InChIKey | RZKMAMGURFKTKH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.03 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |