C27H29ClF2N2S — CID 142590717
N-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-1-[(4-chlorophenyl)methyl]piperidin-4-amine (PubChem CID 142590717) has the molecular formula C27H29ClF2N2S and a molecular weight of 487.06 g/mol. Its IUPAC name is N-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-1-[(4-chlorophenyl)methyl]piperidin-4-amine.
| Compound Name | N-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-1-[(4-chlorophenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 142590717 |
| Molecular Formula | C27H29ClF2N2S |
| Molecular Weight | 487.06 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-[2-[bis(4-fluorophenyl)methylsulfanyl]ethyl]-1-[(4-chlorophenyl)methyl]piperidin-4-amine |
| SMILES | Fc1ccc(C(SCCNC2CCN(Cc3ccc(Cl)cc3)CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H29ClF2N2S/c28-23-7-1-20(2-8-23)19-32-16-13-26(14-17-32)31-15-18-33-27(21-3-9-24(29)10-4-21)22-5-11-25(30)12-6-22/h1-12,26-27,31H,13-19H2 |
| InChIKey | RSFRSNCQWUUVAD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.06 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|