C25H26ClN5O — CID 134139054
4-[[2-chloro-6-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]amino]-4-pyridinyl]oxy]-3,5-dimethylbenzonitrile (PubChem CID 134139054) has the molecular formula C25H26ClN5O and a molecular weight of 447.97 g/mol. Its IUPAC name is 4-[[2-chloro-6-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]amino]-4-pyridinyl]oxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[[2-chloro-6-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]amino]-4-pyridinyl]oxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 134139054 |
| Molecular Formula | C25H26ClN5O |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-[[2-chloro-6-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]amino]-4-pyridinyl]oxy]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1cc(Cl)nc(NC2CCN(Cc3ccncc3)CC2)c1 |
| InChI | InChI=1S/C25H26ClN5O/c1-17-11-20(15-27)12-18(2)25(17)32-22-13-23(26)30-24(14-22)29-21-5-9-31(10-6-21)16-19-3-7-28-8-4-19/h3-4,7-8,11-14,21H,5-6,9-10,16H2,1-2H3,(H,29,30) |
| InChIKey | WYZVEMYGCLUVLS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|