C28H30N4O4 — CID 73053920
4-[3-[[1-[[4-(hydroxymethyl)phenyl]methyl]piperidin-4-yl]amino]-4-nitrophenoxy]-3,5-dimethylbenzonitrile (PubChem CID 73053920) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is 4-[3-[[1-[[4-(hydroxymethyl)phenyl]methyl]piperidin-4-yl]amino]-4-nitrophenoxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[3-[[1-[[4-(hydroxymethyl)phenyl]methyl]piperidin-4-yl]amino]-4-nitrophenoxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 73053920 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 4-[3-[[1-[[4-(hydroxymethyl)phenyl]methyl]piperidin-4-yl]amino]-4-nitrophenoxy]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1ccc([N+](=O)[O-])c(NC2CCN(Cc3ccc(CO)cc3)CC2)c1 |
| InChI | InChI=1S/C28H30N4O4/c1-19-13-23(16-29)14-20(2)28(19)36-25-7-8-27(32(34)35)26(15-25)30-24-9-11-31(12-10-24)17-21-3-5-22(18-33)6-4-21/h3-8,13-15,24,30,33H,9-12,17-18H2,1-2H3 |
| InChIKey | PWQPPGMVADMVKR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|