C27H31N3O3 — CID 73053916
1-benzyl-N-[2-nitro-5-(2,4,6-trimethylphenoxy)phenyl]piperidin-4-amine (PubChem CID 73053916) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-benzyl-N-[2-nitro-5-(2,4,6-trimethylphenoxy)phenyl]piperidin-4-amine.
| Compound Name | 1-benzyl-N-[2-nitro-5-(2,4,6-trimethylphenoxy)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 73053916 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 1-benzyl-N-[2-nitro-5-(2,4,6-trimethylphenoxy)phenyl]piperidin-4-amine |
| SMILES | Cc1cc(C)c(Oc2ccc([N+](=O)[O-])c(NC3CCN(Cc4ccccc4)CC3)c2)c(C)c1 |
| InChI | InChI=1S/C27H31N3O3/c1-19-15-20(2)27(21(3)16-19)33-24-9-10-26(30(31)32)25(17-24)28-23-11-13-29(14-12-23)18-22-7-5-4-6-8-22/h4-10,15-17,23,28H,11-14,18H2,1-3H3 |
| InChIKey | ACAKJFBWGGYRIY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|