C18H21N5OS — CID 134140757
N-[(4-aminophenyl)methyl]-3-(2-methylpropyl)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxamide (PubChem CID 134140757) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-3-(2-methylpropyl)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxamide.
| Compound Name | N-[(4-aminophenyl)methyl]-3-(2-methylpropyl)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134140757 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-3-(2-methylpropyl)-1-(1,3-thiazol-2-yl)pyrazole-4-carboxamide |
| SMILES | CC(C)Cc1nn(-c2nccs2)cc1C(=O)NCc1ccc(N)cc1 |
| InChI | InChI=1S/C18H21N5OS/c1-12(2)9-16-15(11-23(22-16)18-20-7-8-25-18)17(24)21-10-13-3-5-14(19)6-4-13/h3-8,11-12H,9-10,19H2,1-2H3,(H,21,24) |
| InChIKey | TYHAXOKRQJCCIB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|