C16H23F3N2O — CID 134142051
N-methyl-2-[4-[[2-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]ethanamine (PubChem CID 134142051) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is N-methyl-2-[4-[[2-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]ethanamine.
| Compound Name | N-methyl-2-[4-[[2-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 134142051 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-methyl-2-[4-[[2-(trifluoromethyl)phenyl]methoxy]piperidin-1-yl]ethanamine |
| SMILES | CNCCN1CCC(OCc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H23F3N2O/c1-20-8-11-21-9-6-14(7-10-21)22-12-13-4-2-3-5-15(13)16(17,18)19/h2-5,14,20H,6-12H2,1H3 |
| InChIKey | SXNQENMPTCVHFW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |