C20H26NO+ — CID 134145957
4-(2-benzylphenoxy)-1,1-dimethylpiperidin-1-ium (PubChem CID 134145957) has the molecular formula C20H26NO+ and a molecular weight of 296.43 g/mol. Its IUPAC name is 4-(2-benzylphenoxy)-1,1-dimethylpiperidin-1-ium.
| Compound Name | 4-(2-benzylphenoxy)-1,1-dimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 134145957 |
| Molecular Formula | C20H26NO+ |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-(2-benzylphenoxy)-1,1-dimethylpiperidin-1-ium |
| SMILES | C[N+]1(C)CCC(Oc2ccccc2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H26NO/c1-21(2)14-12-19(13-15-21)22-20-11-7-6-10-18(20)16-17-8-4-3-5-9-17/h3-11,19H,12-16H2,1-2H3/q+1 |
| InChIKey | GNOLTODBMIBGTO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|