About (2-benzylphenyl) formate
(2-benzylphenyl) formate (PubChem CID 146231957) has the molecular formula C14H12O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is (2-benzylphenyl) formate.
Molecular Properties
| Compound Name | (2-benzylphenyl) formate |
| PubChem CID | 146231957 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (2-benzylphenyl) formate |
| SMILES | O=COc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C14H12O2/c15-11-16-14-9-5-4-8-13(14)10-12-6-2-1-3-7-12/h1-9,11H,10H2 |
| InChIKey | AIXUJXOQAZPUBS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-benzylphenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzylphenyl) formate?
The IUPAC name of (2-benzylphenyl) formate (CID 146231957) is (2-benzylphenyl) formate.
What is the SMILES notation for (2-benzylphenyl) formate?
The canonical SMILES for (2-benzylphenyl) formate is O=COc1ccccc1Cc1ccccc1.
What is the InChIKey of (2-benzylphenyl) formate?
The InChIKey is AIXUJXOQAZPUBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2/c15-11-16-14-9-5-4-8-13(14)10-12-6-2-1-3-7-12/h1-9,11H,10H2.
What are the key properties of (2-benzylphenyl) formate?
(2-benzylphenyl) formate has a molecular weight of 212.25 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzylphenyl) formate is sourced from PubChem (CID 146231957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).