About (3-amino-4-benzylphenyl) formate
(3-amino-4-benzylphenyl) formate (PubChem CID 158130008) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is (3-amino-4-benzylphenyl) formate.
Molecular Properties
| Compound Name | (3-amino-4-benzylphenyl) formate |
| PubChem CID | 158130008 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (3-amino-4-benzylphenyl) formate |
| SMILES | Nc1cc(OC=O)ccc1Cc1ccccc1 |
| InChI | InChI=1S/C14H13NO2/c15-14-9-13(17-10-16)7-6-12(14)8-11-4-2-1-3-5-11/h1-7,9-10H,8,15H2 |
| InChIKey | XRIDYGLYFDFNKX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-4-benzylphenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-4-benzylphenyl) formate?
The IUPAC name of (3-amino-4-benzylphenyl) formate (CID 158130008) is (3-amino-4-benzylphenyl) formate.
What is the SMILES notation for (3-amino-4-benzylphenyl) formate?
The canonical SMILES for (3-amino-4-benzylphenyl) formate is Nc1cc(OC=O)ccc1Cc1ccccc1.
What is the InChIKey of (3-amino-4-benzylphenyl) formate?
The InChIKey is XRIDYGLYFDFNKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c15-14-9-13(17-10-16)7-6-12(14)8-11-4-2-1-3-5-11/h1-7,9-10H,8,15H2.
What are the key properties of (3-amino-4-benzylphenyl) formate?
(3-amino-4-benzylphenyl) formate has a molecular weight of 227.26 g/mol, XLogP of 2.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-4-benzylphenyl) formate is sourced from PubChem (CID 158130008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).