C23H20N4O3S — CID 134145999
4-[4-(2-aminophenoxy)phenyl]-N-(4-methylsulfonylphenyl)pyrimidin-2-amine (PubChem CID 134145999) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 4-[4-(2-aminophenoxy)phenyl]-N-(4-methylsulfonylphenyl)pyrimidin-2-amine.
| Compound Name | 4-[4-(2-aminophenoxy)phenyl]-N-(4-methylsulfonylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 134145999 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 4-[4-(2-aminophenoxy)phenyl]-N-(4-methylsulfonylphenyl)pyrimidin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2nccc(-c3ccc(Oc4ccccc4N)cc3)n2)cc1 |
| InChI | InChI=1S/C23H20N4O3S/c1-31(28,29)19-12-8-17(9-13-19)26-23-25-15-14-21(27-23)16-6-10-18(11-7-16)30-22-5-3-2-4-20(22)24/h2-15H,24H2,1H3,(H,25,26,27) |
| InChIKey | IORGYFRRDJTHBE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|