C26H28N6O4S — CID 5271326
5-[[4-[2-[4-(4-Aminophenyl)sulfonylanilino]ethoxy]-3-methoxy-phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 5271326) has the molecular formula C26H28N6O4S and a molecular weight of 520.60 g/mol. Its IUPAC name is 5-[[4-[2-[4-(4-aminophenyl)sulfonylanilino]ethoxy]-3-methoxyphenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[4-[2-[4-(4-Aminophenyl)sulfonylanilino]ethoxy]-3-methoxy-phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 5271326 |
| Molecular Formula | C26H28N6O4S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 5-[[4-[2-[4-(4-aminophenyl)sulfonylanilino]ethoxy]-3-methoxyphenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | COC1=C(C=CC(=C1)CC2=CN=C(N=C2N)N)OCCNC3=CC=C(C=C3)S(=O)(=O)C4=CC=C(C=C4)N |
| InChI | InChI=1S/C26H28N6O4S/c1-35-24-15-17(14-18-16-31-26(29)32-25(18)28)2-11-23(24)36-13-12-30-20-5-9-22(10-6-20)37(33,34)21-7-3-19(27)4-8-21/h2-11,15-16,30H,12-14,27H2,1H3,(H4,28,29,31,32) |
| InChIKey | XQAWVWHATMFVDD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | 782 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|