C18H19N5O2 — CID 44532719
5-[[4-(4-aminophenoxy)-3-methoxyphenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 44532719) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 5-[[4-(4-aminophenoxy)-3-methoxyphenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[4-(4-aminophenoxy)-3-methoxyphenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44532719 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 5-[[4-(4-aminophenoxy)-3-methoxyphenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Cc2cnc(N)nc2N)ccc1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C18H19N5O2/c1-24-16-9-11(8-12-10-22-18(21)23-17(12)20)2-7-15(16)25-14-5-3-13(19)4-6-14/h2-7,9-10H,8,19H2,1H3,(H4,20,21,22,23) |
| InChIKey | JEFYIORXNUPTHD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|