C23H23NO6 — CID 134146904
(NE)-N-[(5,6-dimethoxy-1-benzofuran-2-yl)-(5-methoxy-2,2-dimethylchromen-6-yl)methylidene]hydroxylamine (PubChem CID 134146904) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is (NE)-N-[(5,6-dimethoxy-1-benzofuran-2-yl)-(5-methoxy-2,2-dimethylchromen-6-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(5,6-dimethoxy-1-benzofuran-2-yl)-(5-methoxy-2,2-dimethylchromen-6-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 134146904 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (NE)-N-[(5,6-dimethoxy-1-benzofuran-2-yl)-(5-methoxy-2,2-dimethylchromen-6-yl)methylidene]hydroxylamine |
| SMILES | COc1cc2cc(/C(=N/O)c3ccc4c(c3OC)C=CC(C)(C)O4)oc2cc1OC |
| InChI | InChI=1S/C23H23NO6/c1-23(2)9-8-14-16(30-23)7-6-15(22(14)28-5)21(24-25)20-11-13-10-18(26-3)19(27-4)12-17(13)29-20/h6-12,25H,1-5H3/b24-21+ |
| InChIKey | DPVMUZXIRORIHI-DARPEHSRSA-N |
| XLogP | 4.87 |
| TPSA | 82.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|