C29H50N6O7S2 — CID 134147375
tert-butyl N-[4-[(1S,4S,7R,10S,13S)-4-[(2S)-butan-2-yl]-7-(2-methylpropyl)-3,6,9,12,18-pentaoxo-15,16-dithia-2,5,8,11,19-pentazabicyclo[11.4.2]nonadecan-10-yl]butyl]carbamate (PubChem CID 134147375) has the molecular formula C29H50N6O7S2 and a molecular weight of 658.89 g/mol. Its IUPAC name is tert-butyl N-[4-[(1S,4S,7R,10S,13S)-4-[(2S)-butan-2-yl]-7-(2-methylpropyl)-3,6,9,12,18-pentaoxo-15,16-dithia-2,5,8,11,19-pentazabicyclo[11.4.2]nonadecan-10-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1S,4S,7R,10S,13S)-4-[(2S)-butan-2-yl]-7-(2-methylpropyl)-3,6,9,12,18-pentaoxo-15,16-dithia-2,5,8,11,19-pentazabicyclo[11.4.2]nonadecan-10-yl]butyl]carbamate |
|---|---|
| PubChem CID | 134147375 |
| Molecular Formula | C29H50N6O7S2 |
| Molecular Weight | 658.89 g/mol |
| Exact Mass | 658.32 |
| IUPAC Name | tert-butyl N-[4-[(1S,4S,7R,10S,13S)-4-[(2S)-butan-2-yl]-7-(2-methylpropyl)-3,6,9,12,18-pentaoxo-15,16-dithia-2,5,8,11,19-pentazabicyclo[11.4.2]nonadecan-10-yl]butyl]carbamate |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)[C@H]2CSSC[C@@H](NC1=O)C(=O)N2 |
| InChI | InChI=1S/C29H50N6O7S2/c1-8-17(4)22-27(40)34-21-15-44-43-14-20(33-26(21)39)25(38)31-18(11-9-10-12-30-28(41)42-29(5,6)7)23(36)32-19(13-16(2)3)24(37)35-22/h16-22H,8-15H2,1-7H3,(H,30,41)(H,31,38)(H,32,36)(H,33,39)(H,34,40)(H,35,37)/t17-,18-,19+,20+,21+,22-/m0/s1 |
| InChIKey | AAUXIBUOBILLQV-IBJQYKMBSA-N |
| XLogP | 1.61 |
| TPSA | 183.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.89 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|