C12H9Cl2N3O4 — CID 134147879
N-(2,3-dichlorophenyl)-1-methyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide (PubChem CID 134147879) has the molecular formula C12H9Cl2N3O4 and a molecular weight of 330.13 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-1-methyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-1-methyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 134147879 |
| Molecular Formula | C12H9Cl2N3O4 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | N-(2,3-dichlorophenyl)-1-methyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
| SMILES | CN1C(=O)NC(=O)C(C(=O)Nc2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C12H9Cl2N3O4/c1-17-11(20)7(10(19)16-12(17)21)9(18)15-6-4-2-3-5(13)8(6)14/h2-4,7H,1H3,(H,15,18)(H,16,19,21) |
| InChIKey | LBSKROCSUANXBX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|