C33H39Cl2N3O4 — CID 134149281
3,3-bis[4-(2-morpholin-4-ylethoxy)phenyl]-2-phenylprop-2-enenitrile;dihydrochloride (PubChem CID 134149281) has the molecular formula C33H39Cl2N3O4 and a molecular weight of 612.60 g/mol. Its IUPAC name is 3,3-bis[4-(2-morpholin-4-ylethoxy)phenyl]-2-phenylprop-2-enenitrile;dihydrochloride.
| Compound Name | 3,3-bis[4-(2-morpholin-4-ylethoxy)phenyl]-2-phenylprop-2-enenitrile;dihydrochloride |
|---|---|
| PubChem CID | 134149281 |
| Molecular Formula | C33H39Cl2N3O4 |
| Molecular Weight | 612.60 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | 3,3-bis[4-(2-morpholin-4-ylethoxy)phenyl]-2-phenylprop-2-enenitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC(=C(c1ccc(OCCN2CCOCC2)cc1)c1ccc(OCCN2CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H37N3O4.2ClH/c34-26-32(27-4-2-1-3-5-27)33(28-6-10-30(11-7-28)39-24-18-35-14-20-37-21-15-35)29-8-12-31(13-9-29)40-25-19-36-16-22-38-23-17-36;;/h1-13H,14-25H2;2*1H |
| InChIKey | OJHFEHKOVIDYHO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 67.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|