C11H17N5OS — CID 134149319
1-ethyl-3-(6-morpholin-4-ylpyrimidin-4-yl)thiourea (PubChem CID 134149319) has the molecular formula C11H17N5OS and a molecular weight of 267.36 g/mol. Its IUPAC name is 1-ethyl-3-(6-morpholin-4-ylpyrimidin-4-yl)thiourea.
| Compound Name | 1-ethyl-3-(6-morpholin-4-ylpyrimidin-4-yl)thiourea |
|---|---|
| PubChem CID | 134149319 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-ethyl-3-(6-morpholin-4-ylpyrimidin-4-yl)thiourea |
| SMILES | CCNC(=S)Nc1cc(N2CCOCC2)ncn1 |
| InChI | InChI=1S/C11H17N5OS/c1-2-12-11(18)15-9-7-10(14-8-13-9)16-3-5-17-6-4-16/h7-8H,2-6H2,1H3,(H2,12,13,14,15,18) |
| InChIKey | SPEGKWSWXLZYMX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|