C21H31N5O2 — CID 134153167
2-tert-butyl-N-ethyl-4-(furan-2-ylmethylamino)-N-piperidin-3-ylpyrimidine-5-carboxamide (PubChem CID 134153167) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-tert-butyl-N-ethyl-4-(furan-2-ylmethylamino)-N-piperidin-3-ylpyrimidine-5-carboxamide.
| Compound Name | 2-tert-butyl-N-ethyl-4-(furan-2-ylmethylamino)-N-piperidin-3-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 134153167 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 2-tert-butyl-N-ethyl-4-(furan-2-ylmethylamino)-N-piperidin-3-ylpyrimidine-5-carboxamide |
| SMILES | CCN(C(=O)c1cnc(C(C)(C)C)nc1NCc1ccco1)C1CCCNC1 |
| InChI | InChI=1S/C21H31N5O2/c1-5-26(15-8-6-10-22-12-15)19(27)17-14-24-20(21(2,3)4)25-18(17)23-13-16-9-7-11-28-16/h7,9,11,14-15,22H,5-6,8,10,12-13H2,1-4H3,(H,23,24,25) |
| InChIKey | BKCJMJUNTPFDRN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |