C23H37N7O2 — CID 59625238
2-tert-butyl-4-(furan-2-ylmethylamino)-N-[(3R,5S)-5-hydrazinylpiperidin-3-yl]-N-(2-methylpropyl)pyrimidine-5-carboxamide (PubChem CID 59625238) has the molecular formula C23H37N7O2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 2-tert-butyl-4-(furan-2-ylmethylamino)-N-[(3R,5S)-5-hydrazinylpiperidin-3-yl]-N-(2-methylpropyl)pyrimidine-5-carboxamide.
| Compound Name | 2-tert-butyl-4-(furan-2-ylmethylamino)-N-[(3R,5S)-5-hydrazinylpiperidin-3-yl]-N-(2-methylpropyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59625238 |
| Molecular Formula | C23H37N7O2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 2-tert-butyl-4-(furan-2-ylmethylamino)-N-[(3R,5S)-5-hydrazinylpiperidin-3-yl]-N-(2-methylpropyl)pyrimidine-5-carboxamide |
| SMILES | CC(C)CN(C(=O)c1cnc(C(C)(C)C)nc1NCc1ccco1)[C@H]1CNC[C@@H](NN)C1 |
| InChI | InChI=1S/C23H37N7O2/c1-15(2)14-30(17-9-16(29-24)10-25-11-17)21(31)19-13-27-22(23(3,4)5)28-20(19)26-12-18-7-6-8-32-18/h6-8,13,15-17,25,29H,9-12,14,24H2,1-5H3,(H,26,27,28)/t16-,17+/m0/s1 |
| InChIKey | LPVILTJHTFFBRM-DLBZAZTESA-N |
| XLogP | 2.27 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|