C26H26ClN7O3S — CID 134154310
1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-5-N-cyano-3-N-(1-propan-2-ylpiperidin-4-yl)indazole-3,5-dicarboxamide (PubChem CID 134154310) has the molecular formula C26H26ClN7O3S and a molecular weight of 552.06 g/mol. Its IUPAC name is 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-5-N-cyano-3-N-(1-propan-2-ylpiperidin-4-yl)indazole-3,5-dicarboxamide.
| Compound Name | 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-5-N-cyano-3-N-(1-propan-2-ylpiperidin-4-yl)indazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 134154310 |
| Molecular Formula | C26H26ClN7O3S |
| Molecular Weight | 552.06 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-5-N-cyano-3-N-(1-propan-2-ylpiperidin-4-yl)indazole-3,5-dicarboxamide |
| SMILES | CC(C)N1CCC(NC(=O)c2nn(Cc3cc(-c4ccc(Cl)s4)on3)c3ccc(C(=O)NC#N)cc23)CC1 |
| InChI | InChI=1S/C26H26ClN7O3S/c1-15(2)33-9-7-17(8-10-33)30-26(36)24-19-11-16(25(35)29-14-28)3-4-20(19)34(31-24)13-18-12-21(37-32-18)22-5-6-23(27)38-22/h3-6,11-12,15,17H,7-10,13H2,1-2H3,(H,29,35)(H,30,36) |
| InChIKey | GPRXTQVZUIPWGU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.06 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|