C20H33ClN2O — CID 134155855
2-[5-(3,7-dimethyloctoxy)-1H-indol-3-yl]ethanamine;hydrochloride (PubChem CID 134155855) has the molecular formula C20H33ClN2O and a molecular weight of 352.95 g/mol. Its IUPAC name is 2-[5-(3,7-dimethyloctoxy)-1H-indol-3-yl]ethanamine;hydrochloride.
| Compound Name | 2-[5-(3,7-dimethyloctoxy)-1H-indol-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 134155855 |
| Molecular Formula | C20H33ClN2O |
| Molecular Weight | 352.95 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 2-[5-(3,7-dimethyloctoxy)-1H-indol-3-yl]ethanamine;hydrochloride |
| SMILES | CC(C)CCCC(C)CCOc1ccc2[nH]cc(CCN)c2c1.Cl |
| InChI | InChI=1S/C20H32N2O.ClH/c1-15(2)5-4-6-16(3)10-12-23-18-7-8-20-19(13-18)17(9-11-21)14-22-20;/h7-8,13-16,22H,4-6,9-12,21H2,1-3H3;1H |
| InChIKey | PSNXFPXWFVPMQT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.95 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |