C24H48F6N2O4S2 — CID 134159525
bis(trifluoromethylsulfonyl)azanide;didecyl(dimethyl)azanium (PubChem CID 134159525) has the molecular formula C24H48F6N2O4S2 and a molecular weight of 606.78 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;didecyl(dimethyl)azanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;didecyl(dimethyl)azanium |
|---|---|
| PubChem CID | 134159525 |
| Molecular Formula | C24H48F6N2O4S2 |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;didecyl(dimethyl)azanium |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H48N.C2F6NO4S2/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-22H2,1-4H3;/q+1;-1 |
| InChIKey | IBAIYKUBNKTXKO-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|