C9H15NO6 — CID 134159797
(2R,3S)-2,3-dihydroxy-4-oxo-4-piperidin-3-yloxybutanoic acid (PubChem CID 134159797) has the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. Its IUPAC name is (2R,3S)-2,3-dihydroxy-4-oxo-4-piperidin-3-yloxybutanoic acid.
| Compound Name | (2R,3S)-2,3-dihydroxy-4-oxo-4-piperidin-3-yloxybutanoic acid |
|---|---|
| PubChem CID | 134159797 |
| Molecular Formula | C9H15NO6 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (2R,3S)-2,3-dihydroxy-4-oxo-4-piperidin-3-yloxybutanoic acid |
| SMILES | O=C(OC1CCCNC1)[C@@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C9H15NO6/c11-6(8(13)14)7(12)9(15)16-5-2-1-3-10-4-5/h5-7,10-12H,1-4H2,(H,13,14)/t5?,6-,7+/m1/s1 |
| InChIKey | ZKIHDFMIZVFGMU-FWPZAIACSA-N |
| XLogP | -1.91 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |