C9H13N3 — CID 134162273
5-methyl-5,6,7,8-tetrahydrocinnolin-3-amine (PubChem CID 134162273) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-methyl-5,6,7,8-tetrahydrocinnolin-3-amine.
| Compound Name | 5-methyl-5,6,7,8-tetrahydrocinnolin-3-amine |
|---|---|
| PubChem CID | 134162273 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 5-methyl-5,6,7,8-tetrahydrocinnolin-3-amine |
| SMILES | CC1CCCc2nnc(N)cc21 |
| InChI | InChI=1S/C9H13N3/c1-6-3-2-4-8-7(6)5-9(10)12-11-8/h5-6H,2-4H2,1H3,(H2,10,12) |
| InChIKey | MGJSZWLKXUCRAQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |