C10H12N4O3S2 — CID 134162964
[5-(azidomethyl)thiophen-2-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 134162964) has the molecular formula C10H12N4O3S2 and a molecular weight of 300.37 g/mol. Its IUPAC name is [5-(azidomethyl)thiophen-2-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | [5-(azidomethyl)thiophen-2-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 134162964 |
| Molecular Formula | C10H12N4O3S2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | [5-(azidomethyl)thiophen-2-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | [N-]=[N+]=NCc1ccc(C(=O)N2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C10H12N4O3S2/c11-13-12-7-8-1-2-9(18-8)10(15)14-3-5-19(16,17)6-4-14/h1-2H,3-7H2 |
| InChIKey | DWKKYJOYHRNQBK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|