C31H34N4O3 — CID 134163652
methyl (1Z,3R,9Z,13Z,19Z,21S)-11-ethyl-12,16,17,21,26-pentamethyl-4-oxo-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene-3-carboxylate (PubChem CID 134163652) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is methyl (1Z,3R,9Z,13Z,19Z,21S)-11-ethyl-12,16,17,21,26-pentamethyl-4-oxo-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene-3-carboxylate.
| Compound Name | methyl (1Z,3R,9Z,13Z,19Z,21S)-11-ethyl-12,16,17,21,26-pentamethyl-4-oxo-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene-3-carboxylate |
|---|---|
| PubChem CID | 134163652 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | methyl (1Z,3R,9Z,13Z,19Z,21S)-11-ethyl-12,16,17,21,26-pentamethyl-4-oxo-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene-3-carboxylate |
| SMILES | CCc1c(C)/c2[nH]/c1=C\c1[nH]c3c(c1C)C(=O)[C@H](C(=O)OC)/C3=C1\C[C@H](C)/C(=C/c3[nH]c(c(C)c3C)/C=2)N1 |
| InChI | InChI=1S/C31H34N4O3/c1-8-18-16(5)22-11-21-15(4)14(3)20(33-21)10-19-13(2)9-25(32-19)27-28(31(37)38-7)30(36)26-17(6)23(35-29(26)27)12-24(18)34-22/h10-13,28,32-35H,8-9H2,1-7H3/b19-10-,22-11-,24-12-,27-25-/t13-,28+/m0/s1 |
| InChIKey | VZNJXZQCGUVGIU-SHLDMKLGSA-N |
| XLogP | 3.81 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|