C30H32N4O3 — CID 164890042
methyl (1Z,3R,9Z,13Z,19Z,21S,22S)-11-ethyl-12,21,22,26-tetramethyl-4-oxo-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene-3-carboxylate (PubChem CID 164890042) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is methyl (1Z,3R,9Z,13Z,19Z,21S,22S)-11-ethyl-12,21,22,26-tetramethyl-4-oxo-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene-3-carboxylate.
| Compound Name | methyl (1Z,3R,9Z,13Z,19Z,21S,22S)-11-ethyl-12,21,22,26-tetramethyl-4-oxo-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene-3-carboxylate |
|---|---|
| PubChem CID | 164890042 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | methyl (1Z,3R,9Z,13Z,19Z,21S,22S)-11-ethyl-12,21,22,26-tetramethyl-4-oxo-7,23,24,25-tetrazahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13,15,17,19-nonaene-3-carboxylate |
| SMILES | CCc1c(C)/c2[nH]/c1=C\c1[nH]c3c(c1C)C(=O)[C@H](C(=O)OC)/C3=C1/N/C(=C\c3ccc([nH]3)/C=2)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C30H32N4O3/c1-7-19-15(4)21-11-18-9-8-17(31-18)10-20-13(2)14(3)27(33-20)25-26(30(36)37-6)29(35)24-16(5)22(34-28(24)25)12-23(19)32-21/h8-14,26,31-34H,7H2,1-6H3/b20-10-,21-11-,23-12-,27-25-/t13-,14-,26+/m0/s1 |
| InChIKey | GHYBDXVHLBBOGM-QGTXNZNKSA-N |
| XLogP | 3.43 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|