C17H38NO4S+ — CID 134165235
dimethyl-(2-nonoxyethyl)-(4-sulfobutyl)azanium (PubChem CID 134165235) has the molecular formula C17H38NO4S+ and a molecular weight of 352.56 g/mol. Its IUPAC name is dimethyl-(2-nonoxyethyl)-(4-sulfobutyl)azanium.
| Compound Name | dimethyl-(2-nonoxyethyl)-(4-sulfobutyl)azanium |
|---|---|
| PubChem CID | 134165235 |
| Molecular Formula | C17H38NO4S+ |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | dimethyl-(2-nonoxyethyl)-(4-sulfobutyl)azanium |
| SMILES | CCCCCCCCCOCC[N+](C)(C)CCCCS(=O)(=O)O |
| InChI | InChI=1S/C17H37NO4S/c1-4-5-6-7-8-9-11-15-22-16-14-18(2,3)13-10-12-17-23(19,20)21/h4-17H2,1-3H3/p+1 |
| InChIKey | VLCOXODUAWLTOT-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|