C19H27FN6O2 — CID 134165906
N-[9-[(2R,3R,4R,5S)-5-ethenyl-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-6-(methylamino)purin-2-yl]-2-methylpropanamide (PubChem CID 134165906) has the molecular formula C19H27FN6O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5S)-5-ethenyl-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-6-(methylamino)purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,3R,4R,5S)-5-ethenyl-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-6-(methylamino)purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 134165906 |
| Molecular Formula | C19H27FN6O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | N-[9-[(2R,3R,4R,5S)-5-ethenyl-5-ethyl-3-fluoro-4-methyloxolan-2-yl]-6-(methylamino)purin-2-yl]-2-methylpropanamide |
| SMILES | C=C[C@]1(CC)O[C@@H](n2cnc3c(NC)nc(NC(=O)C(C)C)nc32)[C@H](F)[C@@H]1C |
| InChI | InChI=1S/C19H27FN6O2/c1-7-19(8-2)11(5)12(20)17(28-19)26-9-22-13-14(21-6)23-18(24-15(13)26)25-16(27)10(3)4/h7,9-12,17H,1,8H2,2-6H3,(H2,21,23,24,25,27)/t11-,12+,17+,19+/m0/s1 |
| InChIKey | CIVHHKZXENVSFK-XADVXLBKSA-N |
| XLogP | 3.30 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|