C26H23FN6O5 — CID 175677832
N-[2-benzamido-9-[(2R,3R,4R,5R)-5-ethenyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 175677832) has the molecular formula C26H23FN6O5 and a molecular weight of 518.51 g/mol. Its IUPAC name is N-[2-benzamido-9-[(2R,3R,4R,5R)-5-ethenyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[2-benzamido-9-[(2R,3R,4R,5R)-5-ethenyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 175677832 |
| Molecular Formula | C26H23FN6O5 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | N-[2-benzamido-9-[(2R,3R,4R,5R)-5-ethenyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | C=C[C@]1(CO)O[C@@H](n2cnc3c(NC(=O)c4ccccc4)nc(NC(=O)c4ccccc4)nc32)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C26H23FN6O5/c1-2-26(13-34)19(35)17(27)24(38-26)33-14-28-18-20(29-22(36)15-9-5-3-6-10-15)30-25(31-21(18)33)32-23(37)16-11-7-4-8-12-16/h2-12,14,17,19,24,34-35H,1,13H2,(H2,29,30,31,32,36,37)/t17-,19+,24-,26-/m1/s1 |
| InChIKey | WXBOWUJTRNWORO-CZMYDKJZSA-N |
| XLogP | 2.48 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|