C31H26N2O10S — CID 134170099
4-O-[4-hydroxy-2-(4-nitrophenyl)-1,3-benzothiazol-7-yl] 1-O-[4-(prop-2-enoyloxymethoxy)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 134170099) has the molecular formula C31H26N2O10S and a molecular weight of 618.62 g/mol. Its IUPAC name is 4-O-[4-hydroxy-2-(4-nitrophenyl)-1,3-benzothiazol-7-yl] 1-O-[4-(prop-2-enoyloxymethoxy)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[4-hydroxy-2-(4-nitrophenyl)-1,3-benzothiazol-7-yl] 1-O-[4-(prop-2-enoyloxymethoxy)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134170099 |
| Molecular Formula | C31H26N2O10S |
| Molecular Weight | 618.62 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | 4-O-[4-hydroxy-2-(4-nitrophenyl)-1,3-benzothiazol-7-yl] 1-O-[4-(prop-2-enoyloxymethoxy)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(O)c4nc(-c5ccc([N+](=O)[O-])cc5)sc34)CC2)cc1 |
| InChI | InChI=1S/C31H26N2O10S/c1-2-26(35)41-17-40-22-11-13-23(14-12-22)42-30(36)19-3-5-20(6-4-19)31(37)43-25-16-15-24(34)27-28(25)44-29(32-27)18-7-9-21(10-8-18)33(38)39/h2,7-16,19-20,34H,1,3-6,17H2 |
| InChIKey | PUTOJOJUOOYJDA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|