C35H35NO9S2 — CID 139481998
4-O-(4-formyloxy-2-thiophen-2-yl-1,3-benzothiazol-7-yl) 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 139481998) has the molecular formula C35H35NO9S2 and a molecular weight of 677.80 g/mol. Its IUPAC name is 4-O-(4-formyloxy-2-thiophen-2-yl-1,3-benzothiazol-7-yl) 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-(4-formyloxy-2-thiophen-2-yl-1,3-benzothiazol-7-yl) 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139481998 |
| Molecular Formula | C35H35NO9S2 |
| Molecular Weight | 677.80 g/mol |
| Exact Mass | 677.18 |
| IUPAC Name | 4-O-(4-formyloxy-2-thiophen-2-yl-1,3-benzothiazol-7-yl) 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC=O)c4nc(-c5cccs5)sc34)CC2)cc1 |
| InChI | InChI=1S/C35H35NO9S2/c1-2-30(38)42-20-6-4-3-5-19-41-25-13-15-26(16-14-25)44-34(39)23-9-11-24(12-10-23)35(40)45-28-18-17-27(43-22-37)31-32(28)47-33(36-31)29-8-7-21-46-29/h2,7-8,13-18,21-24H,1,3-6,9-12,19-20H2 |
| InChIKey | JGKQBBCTLNPXST-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 127.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.80 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|