C13H9F2N3OS — CID 134175498
2-[2-(difluoromethoxy)-7-methylquinoxalin-5-yl]-1,3-thiazole (PubChem CID 134175498) has the molecular formula C13H9F2N3OS and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)-7-methylquinoxalin-5-yl]-1,3-thiazole.
| Compound Name | 2-[2-(difluoromethoxy)-7-methylquinoxalin-5-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 134175498 |
| Molecular Formula | C13H9F2N3OS |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[2-(difluoromethoxy)-7-methylquinoxalin-5-yl]-1,3-thiazole |
| SMILES | Cc1cc(-c2nccs2)c2ncc(OC(F)F)nc2c1 |
| InChI | InChI=1S/C13H9F2N3OS/c1-7-4-8(12-16-2-3-20-12)11-9(5-7)18-10(6-17-11)19-13(14)15/h2-6,13H,1H3 |
| InChIKey | GSWWWFNZWRLPBY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |