C24H24F2N4O4S — CID 175372454
tert-butyl N-[[2-[2-(difluoromethoxy)-7-methylquinoxalin-5-yl]-1,3-benzothiazol-7-yl]oxy]-N-ethylcarbamate (PubChem CID 175372454) has the molecular formula C24H24F2N4O4S and a molecular weight of 502.54 g/mol. Its IUPAC name is tert-butyl N-[[2-[2-(difluoromethoxy)-7-methylquinoxalin-5-yl]-1,3-benzothiazol-7-yl]oxy]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[[2-[2-(difluoromethoxy)-7-methylquinoxalin-5-yl]-1,3-benzothiazol-7-yl]oxy]-N-ethylcarbamate |
|---|---|
| PubChem CID | 175372454 |
| Molecular Formula | C24H24F2N4O4S |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | tert-butyl N-[[2-[2-(difluoromethoxy)-7-methylquinoxalin-5-yl]-1,3-benzothiazol-7-yl]oxy]-N-ethylcarbamate |
| SMILES | CCN(Oc1cccc2nc(-c3cc(C)cc4nc(OC(F)F)cnc34)sc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H24F2N4O4S/c1-6-30(23(31)33-24(3,4)5)34-17-9-7-8-15-20(17)35-21(29-15)14-10-13(2)11-16-19(14)27-12-18(28-16)32-22(25)26/h7-12,22H,6H2,1-5H3 |
| InChIKey | JYYXRGUTFKJOMD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|