C28H43NO2 — CID 134175706
1-[(1S,3aS,4R,5R,7aS)-5-(4-hydroxy-4-methylcyclohexyl)-7a-methyl-4-propyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-anilinoethanone (PubChem CID 134175706) has the molecular formula C28H43NO2 and a molecular weight of 425.66 g/mol. Its IUPAC name is 1-[(1S,3aS,4R,5R,7aS)-5-(4-hydroxy-4-methylcyclohexyl)-7a-methyl-4-propyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-anilinoethanone.
| Compound Name | 1-[(1S,3aS,4R,5R,7aS)-5-(4-hydroxy-4-methylcyclohexyl)-7a-methyl-4-propyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-anilinoethanone |
|---|---|
| PubChem CID | 134175706 |
| Molecular Formula | C28H43NO2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | 1-[(1S,3aS,4R,5R,7aS)-5-(4-hydroxy-4-methylcyclohexyl)-7a-methyl-4-propyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-anilinoethanone |
| SMILES | CCC[C@@H]1[C@@H](C2CCC(C)(O)CC2)CC[C@]2(C)[C@@H](C(=O)CNc3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C28H43NO2/c1-4-8-23-22(20-13-16-27(2,31)17-14-20)15-18-28(3)24(23)11-12-25(28)26(30)19-29-21-9-6-5-7-10-21/h5-7,9-10,20,22-25,29,31H,4,8,11-19H2,1-3H3/t20?,22-,23-,24+,25-,27?,28+/m1/s1 |
| InChIKey | SQJXJPTUIYNEJR-MFNIOSNBSA-N |
| XLogP | 6.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |