C11H18Cl3NO4 — CID 134176632
[(1S,2S)-1-[(2S)-butan-2-yl]oxy-1-(2,2,2-trichloroethanimidoyl)oxypropan-2-yl] acetate (PubChem CID 134176632) has the molecular formula C11H18Cl3NO4 and a molecular weight of 334.63 g/mol. Its IUPAC name is [(1S,2S)-1-[(2S)-butan-2-yl]oxy-1-(2,2,2-trichloroethanimidoyl)oxypropan-2-yl] acetate.
| Compound Name | [(1S,2S)-1-[(2S)-butan-2-yl]oxy-1-(2,2,2-trichloroethanimidoyl)oxypropan-2-yl] acetate |
|---|---|
| PubChem CID | 134176632 |
| Molecular Formula | C11H18Cl3NO4 |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | [(1S,2S)-1-[(2S)-butan-2-yl]oxy-1-(2,2,2-trichloroethanimidoyl)oxypropan-2-yl] acetate |
| SMILES | [H]/N=C(/O[C@H](O[C@@H](C)CC)[C@H](C)OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl3NO4/c1-5-6(2)17-9(7(3)18-8(4)16)19-10(15)11(12,13)14/h6-7,9,15H,5H2,1-4H3/b15-10+/t6-,7-,9-/m0/s1 |
| InChIKey | PJWWZCMLDKJFKU-OOKITFPVSA-N |
| XLogP | 3.44 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|