C11H10ClN3O — CID 134178519
2-(3-chloroquinolin-6-yl)acetohydrazide (PubChem CID 134178519) has the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. Its IUPAC name is 2-(3-chloroquinolin-6-yl)acetohydrazide.
| Compound Name | 2-(3-chloroquinolin-6-yl)acetohydrazide |
|---|---|
| PubChem CID | 134178519 |
| Molecular Formula | C11H10ClN3O |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-(3-chloroquinolin-6-yl)acetohydrazide |
| SMILES | NNC(=O)Cc1ccc2ncc(Cl)cc2c1 |
| InChI | InChI=1S/C11H10ClN3O/c12-9-5-8-3-7(4-11(16)15-13)1-2-10(8)14-6-9/h1-3,5-6H,4,13H2,(H,15,16) |
| InChIKey | RSGJMNRJVVQTDJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|