C22H15ClN4O2 — CID 24980955
N'-(3-chlorobenzoyl)-2-pyridin-4-ylquinoline-4-carbohydrazide (PubChem CID 24980955) has the molecular formula C22H15ClN4O2 and a molecular weight of 402.84 g/mol. Its IUPAC name is N'-(3-chlorobenzoyl)-2-pyridin-4-ylquinoline-4-carbohydrazide.
| Compound Name | N'-(3-chlorobenzoyl)-2-pyridin-4-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 24980955 |
| Molecular Formula | C22H15ClN4O2 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N'-(3-chlorobenzoyl)-2-pyridin-4-ylquinoline-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccncc2)nc2ccccc12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H15ClN4O2/c23-16-5-3-4-15(12-16)21(28)26-27-22(29)18-13-20(14-8-10-24-11-9-14)25-19-7-2-1-6-17(18)19/h1-13H,(H,26,28)(H,27,29) |
| InChIKey | HIKMJKQGBBIOCN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|