C15H13ClN4O2 — CID 134178625
methyl 2-[(3-chloroquinolin-6-yl)methyl]-5-methyltriazole-4-carboxylate (PubChem CID 134178625) has the molecular formula C15H13ClN4O2 and a molecular weight of 316.75 g/mol. Its IUPAC name is methyl 2-[(3-chloroquinolin-6-yl)methyl]-5-methyltriazole-4-carboxylate.
| Compound Name | methyl 2-[(3-chloroquinolin-6-yl)methyl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 134178625 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | methyl 2-[(3-chloroquinolin-6-yl)methyl]-5-methyltriazole-4-carboxylate |
| SMILES | COC(=O)c1nn(Cc2ccc3ncc(Cl)cc3c2)nc1C |
| InChI | InChI=1S/C15H13ClN4O2/c1-9-14(15(21)22-2)19-20(18-9)8-10-3-4-13-11(5-10)6-12(16)7-17-13/h3-7H,8H2,1-2H3 |
| InChIKey | KAQKIXDQSGTIKB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |