C17H16ClN3O3 — CID 134178614
ethyl 1-[(3-chloroquinolin-6-yl)methyl]-3-(hydroxymethyl)pyrazole-4-carboxylate (PubChem CID 134178614) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is ethyl 1-[(3-chloroquinolin-6-yl)methyl]-3-(hydroxymethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[(3-chloroquinolin-6-yl)methyl]-3-(hydroxymethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 134178614 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | ethyl 1-[(3-chloroquinolin-6-yl)methyl]-3-(hydroxymethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccc3ncc(Cl)cc3c2)nc1CO |
| InChI | InChI=1S/C17H16ClN3O3/c1-2-24-17(23)14-9-21(20-16(14)10-22)8-11-3-4-15-12(5-11)6-13(18)7-19-15/h3-7,9,22H,2,8,10H2,1H3 |
| InChIKey | ZMLMKNXUYJKTFE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |